C16H22ClN3O2S — CID 126635292
2,2-dimethylpropyl N-[4-chloro-2-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-1,3-thiazol-5-yl]-N-methylcarbamate (PubChem CID 126635292) has the molecular formula C16H22ClN3O2S and a molecular weight of 355.89 g/mol. Its IUPAC name is 2,2-dimethylpropyl N-[4-chloro-2-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-1,3-thiazol-5-yl]-N-methylcarbamate.
| Compound Name | 2,2-dimethylpropyl N-[4-chloro-2-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-1,3-thiazol-5-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 126635292 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2,2-dimethylpropyl N-[4-chloro-2-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-1,3-thiazol-5-yl]-N-methylcarbamate |
| SMILES | [H]/N=C/C(=C\C=C/C)c1nc(Cl)c(N(C)C(=O)OCC(C)(C)C)s1 |
| InChI | InChI=1S/C16H22ClN3O2S/c1-6-7-8-11(9-18)13-19-12(17)14(23-13)20(5)15(21)22-10-16(2,3)4/h6-9,18H,10H2,1-5H3/b7-6-,11-8+,18-9+ |
| InChIKey | CUQJQOARWQZXFY-XBSZSZIESA-N |
| XLogP | 5.02 |
| TPSA | 66.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|