C17H14F4O3 — CID 126636242
5-fluoro-2-[4-(4,4,4-trifluorobutoxy)phenoxy]benzaldehyde (PubChem CID 126636242) has the molecular formula C17H14F4O3 and a molecular weight of 342.29 g/mol. Its IUPAC name is 5-fluoro-2-[4-(4,4,4-trifluorobutoxy)phenoxy]benzaldehyde.
| Compound Name | 5-fluoro-2-[4-(4,4,4-trifluorobutoxy)phenoxy]benzaldehyde |
|---|---|
| PubChem CID | 126636242 |
| Molecular Formula | C17H14F4O3 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 5-fluoro-2-[4-(4,4,4-trifluorobutoxy)phenoxy]benzaldehyde |
| SMILES | O=Cc1cc(F)ccc1Oc1ccc(OCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F4O3/c18-13-2-7-16(12(10-13)11-22)24-15-5-3-14(4-6-15)23-9-1-8-17(19,20)21/h2-7,10-11H,1,8-9H2 |
| InChIKey | VPEUOJACBZRKDW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|