C23H41N — CID 126657976
5-[3-(6-bicyclo[3.1.0]hexanyl)-2,2-dimethylpropyl]-2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 126657976) has the molecular formula C23H41N and a molecular weight of 331.59 g/mol. Its IUPAC name is 5-[3-(6-bicyclo[3.1.0]hexanyl)-2,2-dimethylpropyl]-2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | 5-[3-(6-bicyclo[3.1.0]hexanyl)-2,2-dimethylpropyl]-2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 126657976 |
| Molecular Formula | C23H41N |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.32 |
| IUPAC Name | 5-[3-(6-bicyclo[3.1.0]hexanyl)-2,2-dimethylpropyl]-2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CC(C)(CC1CCC2CN(C(C)(C)C)CC2C1)CC1C2CCCC21 |
| InChI | InChI=1S/C23H41N/c1-22(2,3)24-14-17-10-9-16(11-18(17)15-24)12-23(4,5)13-21-19-7-6-8-20(19)21/h16-21H,6-15H2,1-5H3 |
| InChIKey | ISRRXNGXQAQWJX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |