C15H13Cl2N3S2 — CID 126659048
(E)-3-[(2,4-dichlorophenyl)methylsulfanyl]-3-ethylsulfanyl-2-imidazol-1-ylprop-2-enenitrile (PubChem CID 126659048) has the molecular formula C15H13Cl2N3S2 and a molecular weight of 370.33 g/mol. Its IUPAC name is (E)-3-[(2,4-dichlorophenyl)methylsulfanyl]-3-ethylsulfanyl-2-imidazol-1-ylprop-2-enenitrile.
| Compound Name | (E)-3-[(2,4-dichlorophenyl)methylsulfanyl]-3-ethylsulfanyl-2-imidazol-1-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 126659048 |
| Molecular Formula | C15H13Cl2N3S2 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | (E)-3-[(2,4-dichlorophenyl)methylsulfanyl]-3-ethylsulfanyl-2-imidazol-1-ylprop-2-enenitrile |
| SMILES | CCS/C(SCc1ccc(Cl)cc1Cl)=C(/C#N)n1ccnc1 |
| InChI | InChI=1S/C15H13Cl2N3S2/c1-2-21-15(14(8-18)20-6-5-19-10-20)22-9-11-3-4-12(16)7-13(11)17/h3-7,10H,2,9H2,1H3/b15-14+ |
| InChIKey | IUGAWOIZDGTTDX-CCEZHUSRSA-N |
| XLogP | 5.53 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|