C20H18Cl2FNO — CID 126660992
(3E)-3-[1-[3-(2,4-dichlorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one (PubChem CID 126660992) has the molecular formula C20H18Cl2FNO and a molecular weight of 378.27 g/mol. Its IUPAC name is (3E)-3-[1-[3-(2,4-dichlorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one.
| Compound Name | (3E)-3-[1-[3-(2,4-dichlorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one |
|---|---|
| PubChem CID | 126660992 |
| Molecular Formula | C20H18Cl2FNO |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (3E)-3-[1-[3-(2,4-dichlorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one |
| SMILES | C/C(=C1/CCCNC1=O)c1cc(F)cc(-c2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C20H18Cl2FNO/c1-11(15-4-3-7-24-20(15)25)17-9-14(23)10-18(12(17)2)16-6-5-13(21)8-19(16)22/h5-6,8-10H,3-4,7H2,1-2H3,(H,24,25)/b15-11+ |
| InChIKey | ZTWBTRKENIDGJN-RVDMUPIBSA-N |
| XLogP | 5.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|