C22H23F4NO — CID 126661713
(E)-N-butyl-3-[5-fluoro-2-methyl-3-[4-(trifluoromethyl)phenyl]phenyl]-2-methylprop-2-enamide (PubChem CID 126661713) has the molecular formula C22H23F4NO and a molecular weight of 393.42 g/mol. Its IUPAC name is (E)-N-butyl-3-[5-fluoro-2-methyl-3-[4-(trifluoromethyl)phenyl]phenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-butyl-3-[5-fluoro-2-methyl-3-[4-(trifluoromethyl)phenyl]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 126661713 |
| Molecular Formula | C22H23F4NO |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (E)-N-butyl-3-[5-fluoro-2-methyl-3-[4-(trifluoromethyl)phenyl]phenyl]-2-methylprop-2-enamide |
| SMILES | CCCCNC(=O)/C(C)=C/c1cc(F)cc(-c2ccc(C(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C22H23F4NO/c1-4-5-10-27-21(28)14(2)11-17-12-19(23)13-20(15(17)3)16-6-8-18(9-7-16)22(24,25)26/h6-9,11-13H,4-5,10H2,1-3H3,(H,27,28)/b14-11+ |
| InChIKey | LVSTWKWFWDDJIR-SDNWHVSQSA-N |
| XLogP | 6.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|