C21H21F4NO — CID 126661828
(E)-3-[5-fluoro-2-methyl-3-[4-(trifluoromethyl)phenyl]phenyl]-2-methyl-N-propylprop-2-enamide (PubChem CID 126661828) has the molecular formula C21H21F4NO and a molecular weight of 379.40 g/mol. Its IUPAC name is (E)-3-[5-fluoro-2-methyl-3-[4-(trifluoromethyl)phenyl]phenyl]-2-methyl-N-propylprop-2-enamide.
| Compound Name | (E)-3-[5-fluoro-2-methyl-3-[4-(trifluoromethyl)phenyl]phenyl]-2-methyl-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 126661828 |
| Molecular Formula | C21H21F4NO |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (E)-3-[5-fluoro-2-methyl-3-[4-(trifluoromethyl)phenyl]phenyl]-2-methyl-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(C)=C/c1cc(F)cc(-c2ccc(C(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C21H21F4NO/c1-4-9-26-20(27)13(2)10-16-11-18(22)12-19(14(16)3)15-5-7-17(8-6-15)21(23,24)25/h5-8,10-12H,4,9H2,1-3H3,(H,26,27)/b13-10+ |
| InChIKey | WTXATSKFHQBXKO-JLHYYAGUSA-N |
| XLogP | 5.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|