About 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid
2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid (PubChem CID 126663492) has the molecular formula C21H18ClN5O3
and a molecular weight of 423.86 g/mol. Its IUPAC name is 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid |
| PubChem CID | 126663492 |
| Molecular Formula | C21H18ClN5O3 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)n1ccc(-c2cc(Cl)ccc2N2C=NNN2)cc1=O |
| InChI | InChI=1S/C21H18ClN5O3/c22-16-6-7-18(27-13-23-24-25-27)17(12-16)15-8-9-26(20(28)11-15)19(21(29)30)10-14-4-2-1-3-5-14/h1-9,11-13,19,24-25H,10H2,(H,29,30) |
| InChIKey | KCDNLRVENPXELF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid?
The IUPAC name of 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid (CID 126663492) is 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid.
What is the SMILES notation for 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid?
The canonical SMILES for 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid is O=C(O)C(Cc1ccccc1)n1ccc(-c2cc(Cl)ccc2N2C=NNN2)cc1=O.
What is the InChIKey of 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid?
The InChIKey is KCDNLRVENPXELF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClN5O3/c22-16-6-7-18(27-13-23-24-25-27)17(12-16)15-8-9-26(20(28)11-15)19(21(29)30)10-14-4-2-1-3-5-14/h1-9,11-13,19,24-25H,10H2,(H,29,30).
What are the key properties of 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid?
2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid has a molecular weight of 423.86 g/mol, XLogP of 2.81, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-3-phenylpropanoic acid is sourced from PubChem (CID 126663492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).