C30H27ClN4O4 — CID 86299898
4-(5-chloro-2-nitrophenyl)-1-[1-oxo-3-phenyl-1-(2-pyridin-3-ylpiperidin-1-yl)propan-2-yl]pyridin-2-one (PubChem CID 86299898) has the molecular formula C30H27ClN4O4 and a molecular weight of 543.02 g/mol. Its IUPAC name is 4-(5-chloro-2-nitrophenyl)-1-[1-oxo-3-phenyl-1-(2-pyridin-3-ylpiperidin-1-yl)propan-2-yl]pyridin-2-one.
| Compound Name | 4-(5-chloro-2-nitrophenyl)-1-[1-oxo-3-phenyl-1-(2-pyridin-3-ylpiperidin-1-yl)propan-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 86299898 |
| Molecular Formula | C30H27ClN4O4 |
| Molecular Weight | 543.02 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 4-(5-chloro-2-nitrophenyl)-1-[1-oxo-3-phenyl-1-(2-pyridin-3-ylpiperidin-1-yl)propan-2-yl]pyridin-2-one |
| SMILES | O=C(C(Cc1ccccc1)n1ccc(-c2cc(Cl)ccc2[N+](=O)[O-])cc1=O)N1CCCCC1c1cccnc1 |
| InChI | InChI=1S/C30H27ClN4O4/c31-24-11-12-27(35(38)39)25(19-24)22-13-16-33(29(36)18-22)28(17-21-7-2-1-3-8-21)30(37)34-15-5-4-10-26(34)23-9-6-14-32-20-23/h1-3,6-9,11-14,16,18-20,26,28H,4-5,10,15,17H2 |
| InChIKey | RBDCJNIYOFHFCA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.02 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|