C17H8F3NO3S — CID 126667370
4-[5-cyano-2-(trifluoromethyl)-1-benzothiophen-7-yl]-2-hydroxybenzoic acid (PubChem CID 126667370) has the molecular formula C17H8F3NO3S and a molecular weight of 363.32 g/mol. Its IUPAC name is 4-[5-cyano-2-(trifluoromethyl)-1-benzothiophen-7-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[5-cyano-2-(trifluoromethyl)-1-benzothiophen-7-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 126667370 |
| Molecular Formula | C17H8F3NO3S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 4-[5-cyano-2-(trifluoromethyl)-1-benzothiophen-7-yl]-2-hydroxybenzoic acid |
| SMILES | N#Cc1cc(-c2ccc(C(=O)O)c(O)c2)c2sc(C(F)(F)F)cc2c1 |
| InChI | InChI=1S/C17H8F3NO3S/c18-17(19,20)14-6-10-3-8(7-21)4-12(15(10)25-14)9-1-2-11(16(23)24)13(22)5-9/h1-6,22H,(H,23,24) |
| InChIKey | UGBRBABFQWNJCY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |