C18H11N3O3 — CID 126667595
4-(2,6-dicyano-1-methylindol-4-yl)-2-hydroxybenzoic acid (PubChem CID 126667595) has the molecular formula C18H11N3O3 and a molecular weight of 317.30 g/mol. Its IUPAC name is 4-(2,6-dicyano-1-methylindol-4-yl)-2-hydroxybenzoic acid.
| Compound Name | 4-(2,6-dicyano-1-methylindol-4-yl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 126667595 |
| Molecular Formula | C18H11N3O3 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4-(2,6-dicyano-1-methylindol-4-yl)-2-hydroxybenzoic acid |
| SMILES | Cn1c(C#N)cc2c(-c3ccc(C(=O)O)c(O)c3)cc(C#N)cc21 |
| InChI | InChI=1S/C18H11N3O3/c1-21-12(9-20)7-15-14(4-10(8-19)5-16(15)21)11-2-3-13(18(23)24)17(22)6-11/h2-7,22H,1H3,(H,23,24) |
| InChIKey | VPSWHJPSRGDDIR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 110.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |