C16H11NO5 — CID 126649401
methyl 4-(6-cyano-1,3-benzodioxol-4-yl)-2-hydroxybenzoate (PubChem CID 126649401) has the molecular formula C16H11NO5 and a molecular weight of 297.27 g/mol. Its IUPAC name is methyl 4-(6-cyano-1,3-benzodioxol-4-yl)-2-hydroxybenzoate.
| Compound Name | methyl 4-(6-cyano-1,3-benzodioxol-4-yl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 126649401 |
| Molecular Formula | C16H11NO5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | methyl 4-(6-cyano-1,3-benzodioxol-4-yl)-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(-c2cc(C#N)cc3c2OCO3)cc1O |
| InChI | InChI=1S/C16H11NO5/c1-20-16(19)11-3-2-10(6-13(11)18)12-4-9(7-17)5-14-15(12)22-8-21-14/h2-6,18H,8H2,1H3 |
| InChIKey | OBGNWBSBBDXJMP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |