About ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate
ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate (PubChem CID 126668238) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate.
Analyze ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate?
The IUPAC name of ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate (CID 126668238) is ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate.
What is the SMILES notation for ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate?
The canonical SMILES for ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate is CCOC(=O)N1C2CC(C#N)CC1[C@H]1CC21.
What is the InChIKey of ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate?
The InChIKey is YMLWAGZMOJXQQM-YUMZJUHSSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-2-16-12(15)14-10-3-7(6-13)4-11(14)9-5-8(9)10/h7-11H,2-5H2,1H3/t7?,8-,9?,10?,11?/m0/s1.
What are the key properties of ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate?
ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate has a molecular weight of 220.27 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4S)-7-cyano-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate is sourced from PubChem (CID 126668238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).