C13H11NO — CID 126672401
7-methyl-3,4-dihydrocyclopenta[c]isoquinolin-5-one (PubChem CID 126672401) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is 7-methyl-3,4-dihydrocyclopenta[c]isoquinolin-5-one.
| Compound Name | 7-methyl-3,4-dihydrocyclopenta[c]isoquinolin-5-one |
|---|---|
| PubChem CID | 126672401 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 7-methyl-3,4-dihydrocyclopenta[c]isoquinolin-5-one |
| SMILES | Cc1ccc2c3c([nH]c(=O)c2c1)CC=C3 |
| InChI | InChI=1S/C13H11NO/c1-8-5-6-9-10-3-2-4-12(10)14-13(15)11(9)7-8/h2-3,5-7H,4H2,1H3,(H,14,15) |
| InChIKey | RZUMWVKDXBPNIS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |