C11H9NO4 — CID 54703481
4-hydroxy-7-methyl-1-oxo-2H-isoquinoline-3-carboxylic acid (PubChem CID 54703481) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is 4-hydroxy-7-methyl-1-oxo-2H-isoquinoline-3-carboxylic acid.
| Compound Name | 4-hydroxy-7-methyl-1-oxo-2H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54703481 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 4-hydroxy-7-methyl-1-oxo-2H-isoquinoline-3-carboxylic acid |
| SMILES | Cc1ccc2c(O)c(C(=O)O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C11H9NO4/c1-5-2-3-6-7(4-5)10(14)12-8(9(6)13)11(15)16/h2-4,13H,1H3,(H,12,14)(H,15,16) |
| InChIKey | GCXHNWUKEKOPJV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |