C13H23FN2 — CID 126687205
2-[(E,3E)-3-ethylidene-4-methylhex-4-en-2-yl]imino-3-fluorobutan-1-amine (PubChem CID 126687205) has the molecular formula C13H23FN2 and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-[(E,3E)-3-ethylidene-4-methylhex-4-en-2-yl]imino-3-fluorobutan-1-amine.
| Compound Name | 2-[(E,3E)-3-ethylidene-4-methylhex-4-en-2-yl]imino-3-fluorobutan-1-amine |
|---|---|
| PubChem CID | 126687205 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 2-[(E,3E)-3-ethylidene-4-methylhex-4-en-2-yl]imino-3-fluorobutan-1-amine |
| SMILES | C/C=C(C)/C(=C\C)C(C)/N=C(\CN)C(C)F |
| InChI | InChI=1S/C13H23FN2/c1-6-9(3)12(7-2)11(5)16-13(8-15)10(4)14/h6-7,10-11H,8,15H2,1-5H3/b9-6+,12-7+,16-13+ |
| InChIKey | OAAYTXUWAITJLO-CMYLUSQMSA-N |
| XLogP | 3.05 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|