C11H18N2 — CID 123656422
(4E)-4,6-dimethyl-5-[(methylideneamino)methyl]hepta-4,6-dien-2-imine (PubChem CID 123656422) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (4E)-4,6-dimethyl-5-[(methylideneamino)methyl]hepta-4,6-dien-2-imine.
| Compound Name | (4E)-4,6-dimethyl-5-[(methylideneamino)methyl]hepta-4,6-dien-2-imine |
|---|---|
| PubChem CID | 123656422 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (4E)-4,6-dimethyl-5-[(methylideneamino)methyl]hepta-4,6-dien-2-imine |
| SMILES | [H]/N=C(\C)C/C(C)=C(/CN=C)C(=C)C |
| InChI | InChI=1S/C11H18N2/c1-8(2)11(7-13-5)9(3)6-10(4)12/h12H,1,5-7H2,2-4H3/b11-9-,12-10+ |
| InChIKey | SBGGQTDOUGOMJE-DSOJMZEYSA-N |
| XLogP | 3.01 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|