C12H20N2 — CID 145498143
(2Z,6E)-N-ethyl-5-methylideneocta-2,6-dien-4-imine;methanimine (PubChem CID 145498143) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (2Z,6E)-N-ethyl-5-methylideneocta-2,6-dien-4-imine;methanimine.
| Compound Name | (2Z,6E)-N-ethyl-5-methylideneocta-2,6-dien-4-imine;methanimine |
|---|---|
| PubChem CID | 145498143 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (2Z,6E)-N-ethyl-5-methylideneocta-2,6-dien-4-imine;methanimine |
| SMILES | C=C(/C=C/C)C(C=CC)=NCC.[H]N=C |
| InChI | InChI=1S/C11H17N.CH3N/c1-5-8-10(4)11(9-6-2)12-7-3;1-2/h5-6,8-9H,4,7H2,1-3H3;2H,1H2/b8-5+,9-6-,12-11+; |
| InChIKey | JQLQMCSBGZGQTK-BFYCTYLBSA-N |
| XLogP | 3.42 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|