C14H22N2 — CID 143882553
(2Z,4E,7Z)-6-N-ethyl-2,5-dimethyldeca-2,4,7-triene-1,6-diimine (PubChem CID 143882553) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (2Z,4E,7Z)-6-N-ethyl-2,5-dimethyldeca-2,4,7-triene-1,6-diimine.
| Compound Name | (2Z,4E,7Z)-6-N-ethyl-2,5-dimethyldeca-2,4,7-triene-1,6-diimine |
|---|---|
| PubChem CID | 143882553 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (2Z,4E,7Z)-6-N-ethyl-2,5-dimethyldeca-2,4,7-triene-1,6-diimine |
| SMILES | [H]/N=C/C(C)=C\C=C(C)\C(/C=C\CC)=N\CC |
| InChI | InChI=1S/C14H22N2/c1-5-7-8-14(16-6-2)13(4)10-9-12(3)11-15/h7-11,15H,5-6H2,1-4H3/b8-7-,12-9-,13-10+,15-11+,16-14+ |
| InChIKey | WLRRGKUCMOPPGO-GUOYQBPRSA-N |
| XLogP | 3.96 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|