C11H17N3 — CID 163547206
(E)-1-N-methyl-5-N-methylidene-3-(2-methylprop-1-enyl)pent-2-ene-1,4,5-triimine (PubChem CID 163547206) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is (E)-1-N-methyl-5-N-methylidene-3-(2-methylprop-1-enyl)pent-2-ene-1,4,5-triimine.
| Compound Name | (E)-1-N-methyl-5-N-methylidene-3-(2-methylprop-1-enyl)pent-2-ene-1,4,5-triimine |
|---|---|
| PubChem CID | 163547206 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (E)-1-N-methyl-5-N-methylidene-3-(2-methylprop-1-enyl)pent-2-ene-1,4,5-triimine |
| SMILES | [H]/N=C(CN=C)/C(C=C(C)C)=C/C=N/C |
| InChI | InChI=1S/C11H17N3/c1-9(2)7-10(5-6-13-3)11(12)8-14-4/h5-7,12H,4,8H2,1-3H3/b10-5+,12-11+,13-6+ |
| InChIKey | FGAWONIAVBADKY-PZTPYOJSSA-N |
| XLogP | 2.30 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|