C9H16N2O — CID 126693406
3-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,1-dimethylurea (PubChem CID 126693406) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,1-dimethylurea.
| Compound Name | 3-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 126693406 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 3-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,1-dimethylurea |
| SMILES | C/C=C\C(=C/C)NC(=O)N(C)C |
| InChI | InChI=1S/C9H16N2O/c1-5-7-8(6-2)10-9(12)11(3)4/h5-7H,1-4H3,(H,10,12)/b7-5-,8-6+ |
| InChIKey | DVRPEQGGSDLARS-CGXWXWIYSA-N |
| XLogP | 1.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|