C20H40N4O4 — CID 126693677
3-(aminomethyl)-N-[(2S,3S)-1-[[(2S)-1-amino-3-oxobutan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]undecanamide (PubChem CID 126693677) has the molecular formula C20H40N4O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[(2S,3S)-1-[[(2S)-1-amino-3-oxobutan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]undecanamide.
| Compound Name | 3-(aminomethyl)-N-[(2S,3S)-1-[[(2S)-1-amino-3-oxobutan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]undecanamide |
|---|---|
| PubChem CID | 126693677 |
| Molecular Formula | C20H40N4O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 3-(aminomethyl)-N-[(2S,3S)-1-[[(2S)-1-amino-3-oxobutan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]undecanamide |
| SMILES | CCCCCCCCC(CN)CC(=O)N[C@H](C(=O)N[C@@H](CN)C(C)=O)[C@H](C)O |
| InChI | InChI=1S/C20H40N4O4/c1-4-5-6-7-8-9-10-16(12-21)11-18(27)24-19(15(3)26)20(28)23-17(13-22)14(2)25/h15-17,19,26H,4-13,21-22H2,1-3H3,(H,23,28)(H,24,27)/t15-,16?,17-,19-/m0/s1 |
| InChIKey | VBQIJXHMANSYDC-LWYGHXEJSA-N |
| XLogP | 0.60 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|