C19H16F6N2O4S — CID 126693732
(3S,4S,5R)-3-amino-5-[3,7-bis(trifluoromethyl)phenoxazin-10-yl]-1,1-dioxothian-4-ol (PubChem CID 126693732) has the molecular formula C19H16F6N2O4S and a molecular weight of 482.40 g/mol. Its IUPAC name is (3S,4S,5R)-3-amino-5-[3,7-bis(trifluoromethyl)phenoxazin-10-yl]-1,1-dioxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-amino-5-[3,7-bis(trifluoromethyl)phenoxazin-10-yl]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 126693732 |
| Molecular Formula | C19H16F6N2O4S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | (3S,4S,5R)-3-amino-5-[3,7-bis(trifluoromethyl)phenoxazin-10-yl]-1,1-dioxothian-4-ol |
| SMILES | N[C@@H]1CS(=O)(=O)C[C@H](N2c3ccc(C(F)(F)F)cc3Oc3cc(C(F)(F)F)ccc32)[C@H]1O |
| InChI | InChI=1S/C19H16F6N2O4S/c20-18(21,22)9-1-3-12-15(5-9)31-16-6-10(19(23,24)25)2-4-13(16)27(12)14-8-32(29,30)7-11(26)17(14)28/h1-6,11,14,17,28H,7-8,26H2/t11-,14+,17+/m1/s1 |
| InChIKey | CJJIWXLDTYQKFZ-WHCBVINPSA-N |
| XLogP | 3.45 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |