C37H35N5O5S — CID 126694581
3-[3,6-bis(dimethylamino)-9-methoxyxanthen-9-yl]-N-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propyl]-4-formylbenzamide (PubChem CID 126694581) has the molecular formula C37H35N5O5S and a molecular weight of 661.78 g/mol. Its IUPAC name is 3-[3,6-bis(dimethylamino)-9-methoxyxanthen-9-yl]-N-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propyl]-4-formylbenzamide.
| Compound Name | 3-[3,6-bis(dimethylamino)-9-methoxyxanthen-9-yl]-N-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propyl]-4-formylbenzamide |
|---|---|
| PubChem CID | 126694581 |
| Molecular Formula | C37H35N5O5S |
| Molecular Weight | 661.78 g/mol |
| Exact Mass | 661.24 |
| IUPAC Name | 3-[3,6-bis(dimethylamino)-9-methoxyxanthen-9-yl]-N-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propyl]-4-formylbenzamide |
| SMILES | COC1(c2cc(C(=O)NCCCOc3ccc4nc(C#N)sc4c3)ccc2C=O)c2ccc(N(C)C)cc2Oc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C37H35N5O5S/c1-41(2)25-9-12-28-32(18-25)47-33-19-26(42(3)4)10-13-29(33)37(28,45-5)30-17-23(7-8-24(30)22-43)36(44)39-15-6-16-46-27-11-14-31-34(20-27)48-35(21-38)40-31/h7-14,17-20,22H,6,15-16H2,1-5H3,(H,39,44) |
| InChIKey | XXPCXEKSPPYTEK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.78 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|