C26H26N2O7 — CID 145400995
N-[2-(2-aminoethoxy)ethyl]-4-(3,6-dihydroxy-9-methoxyxanthen-9-yl)-3-formylbenzamide (PubChem CID 145400995) has the molecular formula C26H26N2O7 and a molecular weight of 478.50 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-4-(3,6-dihydroxy-9-methoxyxanthen-9-yl)-3-formylbenzamide.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-4-(3,6-dihydroxy-9-methoxyxanthen-9-yl)-3-formylbenzamide |
|---|---|
| PubChem CID | 145400995 |
| Molecular Formula | C26H26N2O7 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-4-(3,6-dihydroxy-9-methoxyxanthen-9-yl)-3-formylbenzamide |
| SMILES | COC1(c2ccc(C(=O)NCCOCCN)cc2C=O)c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C26H26N2O7/c1-33-26(20-5-2-16(12-17(20)15-29)25(32)28-9-11-34-10-8-27)21-6-3-18(30)13-23(21)35-24-14-19(31)4-7-22(24)26/h2-7,12-15,30-31H,8-11,27H2,1H3,(H,28,32) |
| InChIKey | VJJBIZZACGDXHW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|