About 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole
6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole (PubChem CID 126695991) has the molecular formula C16H20F3N3O
and a molecular weight of 327.35 g/mol. Its IUPAC name is 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole.
Molecular Properties
| Compound Name | 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole |
| PubChem CID | 126695991 |
| Molecular Formula | C16H20F3N3O |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole |
| SMILES | CC(C(F)F)N1CCC(COc2cc(F)c3cn[nH]c3c2)CC1 |
| InChI | InChI=1S/C16H20F3N3O/c1-10(16(18)19)22-4-2-11(3-5-22)9-23-12-6-14(17)13-8-20-21-15(13)7-12/h6-8,10-11,16H,2-5,9H2,1H3,(H,20,21) |
| InChIKey | WDXPHSMSBKUCBQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole?
The IUPAC name of 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole (CID 126695991) is 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole.
What is the SMILES notation for 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole?
The canonical SMILES for 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole is CC(C(F)F)N1CCC(COc2cc(F)c3cn[nH]c3c2)CC1.
What is the InChIKey of 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole?
The InChIKey is WDXPHSMSBKUCBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F3N3O/c1-10(16(18)19)22-4-2-11(3-5-22)9-23-12-6-14(17)13-8-20-21-15(13)7-12/h6-8,10-11,16H,2-5,9H2,1H3,(H,20,21).
What are the key properties of 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole?
6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole has a molecular weight of 327.35 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[1-(1,1-difluoropropan-2-yl)piperidin-4-yl]methoxy]-4-fluoro-1H-indazole is sourced from PubChem (CID 126695991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).