C17H16N4O2S2 — CID 126697071
3-[4-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)piperazin-1-yl]benzamide (PubChem CID 126697071) has the molecular formula C17H16N4O2S2 and a molecular weight of 372.48 g/mol. Its IUPAC name is 3-[4-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)piperazin-1-yl]benzamide.
| Compound Name | 3-[4-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 126697071 |
| Molecular Formula | C17H16N4O2S2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 3-[4-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1cccc(N2CCN(c3nc4ccsc4c(=O)s3)CC2)c1 |
| InChI | InChI=1S/C17H16N4O2S2/c18-15(22)11-2-1-3-12(10-11)20-5-7-21(8-6-20)17-19-13-4-9-24-14(13)16(23)25-17/h1-4,9-10H,5-8H2,(H2,18,22) |
| InChIKey | VCXWHKJHDGYZQT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |