C29H37N3O3 — CID 126697802
methyl (E)-3-[3-[[1-[[1-(4-aminophenyl)piperidin-4-yl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate (PubChem CID 126697802) has the molecular formula C29H37N3O3 and a molecular weight of 475.63 g/mol. Its IUPAC name is methyl (E)-3-[3-[[1-[[1-(4-aminophenyl)piperidin-4-yl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[[1-[[1-(4-aminophenyl)piperidin-4-yl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 126697802 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | methyl (E)-3-[3-[[1-[[1-(4-aminophenyl)piperidin-4-yl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(NC(=O)C2(CC3CCN(c4ccc(N)cc4)CC3)CCCCC2)c1 |
| InChI | InChI=1S/C29H37N3O3/c1-35-27(33)13-8-22-6-5-7-25(20-22)31-28(34)29(16-3-2-4-17-29)21-23-14-18-32(19-15-23)26-11-9-24(30)10-12-26/h5-13,20,23H,2-4,14-19,21,30H2,1H3,(H,31,34)/b13-8+ |
| InChIKey | SZZTYJHOGKBHIE-MDWZMJQESA-N |
| XLogP | 5.65 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|