C31H39NO4 — CID 126697820
(E)-3-[3-[[1-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 126697820) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol. Its IUPAC name is (E)-3-[3-[[1-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[1-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126697820 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | (E)-3-[3-[[1-[[4-(4-methoxy-3-methylphenyl)cyclohexyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(C2CCC(CC3(C(=O)Nc4cccc(/C=C/C(=O)O)c4)CCCCC3)CC2)cc1C |
| InChI | InChI=1S/C31H39NO4/c1-22-19-26(14-15-28(22)36-2)25-12-9-24(10-13-25)21-31(17-4-3-5-18-31)30(35)32-27-8-6-7-23(20-27)11-16-29(33)34/h6-8,11,14-16,19-20,24-25H,3-5,9-10,12-13,17-18,21H2,1-2H3,(H,32,35)(H,33,34)/b16-11+ |
| InChIKey | FRCOJCRWSRZXRV-LFIBNONCSA-N |
| XLogP | 7.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|