C29H37N3O3 — CID 135310419
methyl (E)-3-[3-[[1-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate (PubChem CID 135310419) has the molecular formula C29H37N3O3 and a molecular weight of 475.63 g/mol. Its IUPAC name is methyl (E)-3-[3-[[1-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[[1-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 135310419 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | methyl (E)-3-[3-[[1-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(NC(=O)C2(Cc3ccc(N4CCN(C)CC4)cc3)CCCCC2)c1 |
| InChI | InChI=1S/C29H37N3O3/c1-31-17-19-32(20-18-31)26-12-9-24(10-13-26)22-29(15-4-3-5-16-29)28(34)30-25-8-6-7-23(21-25)11-14-27(33)35-2/h6-14,21H,3-5,15-20,22H2,1-2H3,(H,30,34)/b14-11+ |
| InChIKey | WUOSEZSCKPBPOS-SDNWHVSQSA-N |
| XLogP | 4.76 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|