C27H31N5O3 — CID 126697835
(E)-3-[3-[[1-[[1-[6-(dimethylamino)-3-pyridinyl]pyrazol-4-yl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 126697835) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is (E)-3-[3-[[1-[[1-[6-(dimethylamino)-3-pyridinyl]pyrazol-4-yl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[1-[[1-[6-(dimethylamino)-3-pyridinyl]pyrazol-4-yl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126697835 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (E)-3-[3-[[1-[[1-[6-(dimethylamino)-3-pyridinyl]pyrazol-4-yl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN(C)c1ccc(-n2cc(CC3(C(=O)Nc4cccc(/C=C/C(=O)O)c4)CCCCC3)cn2)cn1 |
| InChI | InChI=1S/C27H31N5O3/c1-31(2)24-11-10-23(18-28-24)32-19-21(17-29-32)16-27(13-4-3-5-14-27)26(35)30-22-8-6-7-20(15-22)9-12-25(33)34/h6-12,15,17-19H,3-5,13-14,16H2,1-2H3,(H,30,35)(H,33,34)/b12-9+ |
| InChIKey | RNAAQKHNOUOOSH-FMIVXFBMSA-N |
| XLogP | 4.56 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|