C32H36N2O3 — CID 135310190
(E)-3-[5-[[1-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarbonyl]amino]-2-methylphenyl]prop-2-enoic acid (PubChem CID 135310190) has the molecular formula C32H36N2O3 and a molecular weight of 496.65 g/mol. Its IUPAC name is (E)-3-[5-[[1-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarbonyl]amino]-2-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[[1-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarbonyl]amino]-2-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135310190 |
| Molecular Formula | C32H36N2O3 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | (E)-3-[5-[[1-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarbonyl]amino]-2-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(NC(=O)C2(Cc3ccc(-c4ccc(N(C)C)cc4)cc3)CCCCC2)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C32H36N2O3/c1-23-7-15-28(21-27(23)14-18-30(35)36)33-31(37)32(19-5-4-6-20-32)22-24-8-10-25(11-9-24)26-12-16-29(17-13-26)34(2)3/h7-18,21H,4-6,19-20,22H2,1-3H3,(H,33,37)(H,35,36)/b18-14+ |
| InChIKey | XCCUZHHWLQTEFX-NBVRZTHBSA-N |
| XLogP | 6.96 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|