C34H37N3O3 — CID 174158665
ethyl (E)-3-[3-[[1-[[3-cyano-4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate (PubChem CID 174158665) has the molecular formula C34H37N3O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is ethyl (E)-3-[3-[[1-[[3-cyano-4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[[1-[[3-cyano-4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 174158665 |
| Molecular Formula | C34H37N3O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | ethyl (E)-3-[3-[[1-[[3-cyano-4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarbonyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(NC(=O)C2(Cc3ccc(-c4ccc(N(C)C)cc4)c(C#N)c3)CCCCC2)c1 |
| InChI | InChI=1S/C34H37N3O3/c1-4-40-32(38)18-12-25-9-8-10-29(22-25)36-33(39)34(19-6-5-7-20-34)23-26-11-17-31(28(21-26)24-35)27-13-15-30(16-14-27)37(2)3/h8-18,21-22H,4-7,19-20,23H2,1-3H3,(H,36,39)/b18-12+ |
| InChIKey | LLCLLNLMVYQHGG-LDADJPATSA-N |
| XLogP | 7.00 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|