About 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine
5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine (PubChem CID 126700631) has the molecular formula C23H21BrN2O3
and a molecular weight of 453.34 g/mol. Its IUPAC name is 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine |
| PubChem CID | 126700631 |
| Molecular Formula | C23H21BrN2O3 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2nc3cc(Br)ccc3o2)cc1 |
| InChI | InChI=1S/C23H21BrN2O3/c1-27-19-8-3-16(4-9-19)14-26(15-17-5-10-20(28-2)11-6-17)23-25-21-13-18(24)7-12-22(21)29-23/h3-13H,14-15H2,1-2H3 |
| InChIKey | PWPQCQIITVLKQQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine?
The IUPAC name of 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine (CID 126700631) is 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine.
What is the SMILES notation for 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine?
The canonical SMILES for 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine is COc1ccc(CN(Cc2ccc(OC)cc2)c2nc3cc(Br)ccc3o2)cc1.
What is the InChIKey of 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine?
The InChIKey is PWPQCQIITVLKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21BrN2O3/c1-27-19-8-3-16(4-9-19)14-26(15-17-5-10-20(28-2)11-6-17)23-25-21-13-18(24)7-12-22(21)29-23/h3-13H,14-15H2,1-2H3.
What are the key properties of 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine?
5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine has a molecular weight of 453.34 g/mol, XLogP of 5.81, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,N-bis[(4-methoxyphenyl)methyl]-1,3-benzoxazol-2-amine is sourced from PubChem (CID 126700631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).