C59H86O16 — CID 126703321
9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-9-[3,4-bis[2-(2-propoxyethoxy)ethylperoxy]phenyl]-2-methyl-7-(2-methylbutan-2-yl)fluorene (PubChem CID 126703321) has the molecular formula C59H86O16 and a molecular weight of 1051.32 g/mol. Its IUPAC name is 9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-9-[3,4-bis[2-(2-propoxyethoxy)ethylperoxy]phenyl]-2-methyl-7-(2-methylbutan-2-yl)fluorene.
| Compound Name | 9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-9-[3,4-bis[2-(2-propoxyethoxy)ethylperoxy]phenyl]-2-methyl-7-(2-methylbutan-2-yl)fluorene |
|---|---|
| PubChem CID | 126703321 |
| Molecular Formula | C59H86O16 |
| Molecular Weight | 1051.32 g/mol |
| Exact Mass | 1050.59 |
| IUPAC Name | 9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-9-[3,4-bis[2-(2-propoxyethoxy)ethylperoxy]phenyl]-2-methyl-7-(2-methylbutan-2-yl)fluorene |
| SMILES | CCCOCCOCCOOc1ccc(C2(c3ccc(OCCOCCOCCOC)c(OCCOCCOCCOC)c3)c3cc(C)ccc3-c3ccc(C(C)(C)CC)cc32)cc1OOCCOCCOCCC |
| InChI | InChI=1S/C59H86O16/c1-9-20-62-26-28-68-36-40-72-74-55-19-15-49(45-57(55)75-73-41-37-69-29-27-63-21-10-2)59(52-42-46(4)12-16-50(52)51-17-13-47(43-53(51)59)58(5,6)11-3)48-14-18-54(70-38-34-66-32-30-64-24-22-60-7)56(44-48)71-39-35-67-33-31-65-25-23-61-8/h12-19,42-45H,9-11,20-41H2,1-8H3 |
| InChIKey | AUYPKGDMLQWXJF-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 147.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.32 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|