C61H90O16 — CID 155051621
9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-9-[3,4-bis[2-(2-propoxyethoxy)ethylperoxy]phenyl]-2,7-ditert-butylfluorene (PubChem CID 155051621) has the molecular formula C61H90O16 and a molecular weight of 1079.37 g/mol. Its IUPAC name is 9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-9-[3,4-bis[2-(2-propoxyethoxy)ethylperoxy]phenyl]-2,7-ditert-butylfluorene.
| Compound Name | 9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-9-[3,4-bis[2-(2-propoxyethoxy)ethylperoxy]phenyl]-2,7-ditert-butylfluorene |
|---|---|
| PubChem CID | 155051621 |
| Molecular Formula | C61H90O16 |
| Molecular Weight | 1079.37 g/mol |
| Exact Mass | 1078.62 |
| IUPAC Name | 9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-9-[3,4-bis[2-(2-propoxyethoxy)ethylperoxy]phenyl]-2,7-ditert-butylfluorene |
| SMILES | CCCOCCOCCOOc1ccc(C2(c3ccc(OCCOCCOCCOC)c(OCCOCCOCCOC)c3)c3cc(C(C)(C)C)ccc3-c3ccc(C(C)(C)C)cc32)cc1OOCCOCCOCCC |
| InChI | InChI=1S/C61H90O16/c1-11-21-64-27-29-70-37-41-74-76-56-20-16-50(46-58(56)77-75-42-38-71-30-28-65-22-12-2)61(53-43-47(59(3,4)5)13-17-51(53)52-18-14-48(44-54(52)61)60(6,7)8)49-15-19-55(72-39-35-68-33-31-66-25-23-62-9)57(45-49)73-40-36-69-34-32-67-26-24-63-10/h13-20,43-46H,11-12,21-42H2,1-10H3 |
| InChIKey | JPFQJUFUWSTSIT-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 147.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.37 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|