C40H54O10 — CID 153278369
5-[9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2,7-dimethylfluoren-9-yl]pentanoic acid (PubChem CID 153278369) has the molecular formula C40H54O10 and a molecular weight of 694.86 g/mol. Its IUPAC name is 5-[9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2,7-dimethylfluoren-9-yl]pentanoic acid.
| Compound Name | 5-[9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2,7-dimethylfluoren-9-yl]pentanoic acid |
|---|---|
| PubChem CID | 153278369 |
| Molecular Formula | C40H54O10 |
| Molecular Weight | 694.86 g/mol |
| Exact Mass | 694.37 |
| IUPAC Name | 5-[9-[3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2,7-dimethylfluoren-9-yl]pentanoic acid |
| SMILES | COCCOCCOCCOc1ccc(C2(CCCCC(=O)O)c3cc(C)ccc3-c3ccc(C)cc32)cc1OCCOCCOCCOC |
| InChI | InChI=1S/C40H54O10/c1-30-8-11-33-34-12-9-31(2)28-36(34)40(35(33)27-30,14-6-5-7-39(41)42)32-10-13-37(49-25-23-47-21-19-45-17-15-43-3)38(29-32)50-26-24-48-22-20-46-18-16-44-4/h8-13,27-29H,5-7,14-26H2,1-4H3,(H,41,42) |
| InChIKey | LPSNUDGRQSTPHK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.86 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|