C34H40O8 — CID 153278368
5-[9-(4-carboxybutyl)-2,7-dimethylfluoren-9-yl]-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzoic acid (PubChem CID 153278368) has the molecular formula C34H40O8 and a molecular weight of 576.69 g/mol. Its IUPAC name is 5-[9-(4-carboxybutyl)-2,7-dimethylfluoren-9-yl]-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzoic acid.
| Compound Name | 5-[9-(4-carboxybutyl)-2,7-dimethylfluoren-9-yl]-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 153278368 |
| Molecular Formula | C34H40O8 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 5-[9-(4-carboxybutyl)-2,7-dimethylfluoren-9-yl]-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzoic acid |
| SMILES | COCCOCCOCCOc1ccc(C2(CCCCC(=O)O)c3cc(C)ccc3-c3ccc(C)cc32)cc1C(=O)O |
| InChI | InChI=1S/C34H40O8/c1-23-7-10-26-27-11-8-24(2)21-30(27)34(29(26)20-23,13-5-4-6-32(35)36)25-9-12-31(28(22-25)33(37)38)42-19-18-41-17-16-40-15-14-39-3/h7-12,20-22H,4-6,13-19H2,1-3H3,(H,35,36)(H,37,38) |
| InChIKey | HZSRFWMLAAZJTJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|