C14H19IN2O4 — CID 126703724
diethyl 3-iodo-1-[(1-methylcyclopropyl)methyl]pyrazole-4,5-dicarboxylate (PubChem CID 126703724) has the molecular formula C14H19IN2O4 and a molecular weight of 406.22 g/mol. Its IUPAC name is diethyl 3-iodo-1-[(1-methylcyclopropyl)methyl]pyrazole-4,5-dicarboxylate.
| Compound Name | diethyl 3-iodo-1-[(1-methylcyclopropyl)methyl]pyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 126703724 |
| Molecular Formula | C14H19IN2O4 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | diethyl 3-iodo-1-[(1-methylcyclopropyl)methyl]pyrazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(I)nn(CC2(C)CC2)c1C(=O)OCC |
| InChI | InChI=1S/C14H19IN2O4/c1-4-20-12(18)9-10(13(19)21-5-2)17(16-11(9)15)8-14(3)6-7-14/h4-8H2,1-3H3 |
| InChIKey | UIRZHVYQWINLFK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|