C19H28IN3O6 — CID 118062403
diethyl 1-[2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-iodopyrazole-4,5-dicarboxylate (PubChem CID 118062403) has the molecular formula C19H28IN3O6 and a molecular weight of 521.35 g/mol. Its IUPAC name is diethyl 1-[2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-iodopyrazole-4,5-dicarboxylate.
| Compound Name | diethyl 1-[2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-iodopyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 118062403 |
| Molecular Formula | C19H28IN3O6 |
| Molecular Weight | 521.35 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | diethyl 1-[2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-iodopyrazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(I)nn(CC(NC(=O)OC(C)(C)C)C2CC2)c1C(=O)OCC |
| InChI | InChI=1S/C19H28IN3O6/c1-6-27-16(24)13-14(17(25)28-7-2)23(22-15(13)20)10-12(11-8-9-11)21-18(26)29-19(3,4)5/h11-12H,6-10H2,1-5H3,(H,21,26) |
| InChIKey | CIHMYRDNORRRPH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|