C10H6F4N4O — CID 126708256
1-[[(2S)-2-(2,4-difluorophenyl)-3,3-difluorooxiran-2-yl]methyl]tetrazole (PubChem CID 126708256) has the molecular formula C10H6F4N4O and a molecular weight of 274.18 g/mol. Its IUPAC name is 1-[[(2S)-2-(2,4-difluorophenyl)-3,3-difluorooxiran-2-yl]methyl]tetrazole.
| Compound Name | 1-[[(2S)-2-(2,4-difluorophenyl)-3,3-difluorooxiran-2-yl]methyl]tetrazole |
|---|---|
| PubChem CID | 126708256 |
| Molecular Formula | C10H6F4N4O |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-[[(2S)-2-(2,4-difluorophenyl)-3,3-difluorooxiran-2-yl]methyl]tetrazole |
| SMILES | Fc1ccc([C@@]2(Cn3cnnn3)OC2(F)F)c(F)c1 |
| InChI | InChI=1S/C10H6F4N4O/c11-6-1-2-7(8(12)3-6)9(10(13,14)19-9)4-18-5-15-16-17-18/h1-3,5H,4H2/t9-/m1/s1 |
| InChIKey | APFPUFOPKIEHQQ-SECBINFHSA-N |
| XLogP | 1.47 |
| TPSA | 56.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|