About [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol
[2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol (PubChem CID 126708776) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol |
| PubChem CID | 126708776 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol |
| SMILES | CC1(C)OC[C@@H](COc2ncccc2CO)O1 |
| InChI | InChI=1S/C12H17NO4/c1-12(2)16-8-10(17-12)7-15-11-9(6-14)4-3-5-13-11/h3-5,10,14H,6-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | YNMZJSBGNYTLHK-SNVBAGLBSA-N |
| XLogP | 1.10 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol?
The IUPAC name of [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol (CID 126708776) is [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol.
What is the SMILES notation for [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol?
The canonical SMILES for [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol is CC1(C)OC[C@@H](COc2ncccc2CO)O1.
What is the InChIKey of [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol?
The InChIKey is YNMZJSBGNYTLHK-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H17NO4/c1-12(2)16-8-10(17-12)7-15-11-9(6-14)4-3-5-13-11/h3-5,10,14H,6-8H2,1-2H3/t10-/m1/s1.
What are the key properties of [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol?
[2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol has a molecular weight of 239.27 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-pyridinyl]methanol is sourced from PubChem (CID 126708776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).