C15H13Cl2FN2O3 — CID 126720280
3,5-dichloro-2-[2-(2-fluoro-4-nitrophenoxy)propan-2-yl]-6-methylpyridine (PubChem CID 126720280) has the molecular formula C15H13Cl2FN2O3 and a molecular weight of 359.18 g/mol. Its IUPAC name is 3,5-dichloro-2-[2-(2-fluoro-4-nitrophenoxy)propan-2-yl]-6-methylpyridine.
| Compound Name | 3,5-dichloro-2-[2-(2-fluoro-4-nitrophenoxy)propan-2-yl]-6-methylpyridine |
|---|---|
| PubChem CID | 126720280 |
| Molecular Formula | C15H13Cl2FN2O3 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 3,5-dichloro-2-[2-(2-fluoro-4-nitrophenoxy)propan-2-yl]-6-methylpyridine |
| SMILES | Cc1nc(C(C)(C)Oc2ccc([N+](=O)[O-])cc2F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2FN2O3/c1-8-10(16)7-11(17)14(19-8)15(2,3)23-13-5-4-9(20(21)22)6-12(13)18/h4-7H,1-3H3 |
| InChIKey | YCAGJLQTRUGGNC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|