C18H11Cl2N5O3 — CID 126721015
1-[2-[(2,5-dichlorophenyl)methyl]-1,3-dioxoisoindol-4-yl]triazole-4-carboxamide (PubChem CID 126721015) has the molecular formula C18H11Cl2N5O3 and a molecular weight of 416.22 g/mol. Its IUPAC name is 1-[2-[(2,5-dichlorophenyl)methyl]-1,3-dioxoisoindol-4-yl]triazole-4-carboxamide.
| Compound Name | 1-[2-[(2,5-dichlorophenyl)methyl]-1,3-dioxoisoindol-4-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 126721015 |
| Molecular Formula | C18H11Cl2N5O3 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 1-[2-[(2,5-dichlorophenyl)methyl]-1,3-dioxoisoindol-4-yl]triazole-4-carboxamide |
| SMILES | NC(=O)c1cn(-c2cccc3c2C(=O)N(Cc2cc(Cl)ccc2Cl)C3=O)nn1 |
| InChI | InChI=1S/C18H11Cl2N5O3/c19-10-4-5-12(20)9(6-10)7-24-17(27)11-2-1-3-14(15(11)18(24)28)25-8-13(16(21)26)22-23-25/h1-6,8H,7H2,(H2,21,26) |
| InChIKey | DSBJNHZDSUZAHX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|