C18H13ClN4O2 — CID 177375988
2-[[1-[(3-chlorophenyl)methyl]triazol-4-yl]methyl]isoindole-1,3-dione (PubChem CID 177375988) has the molecular formula C18H13ClN4O2 and a molecular weight of 352.78 g/mol. Its IUPAC name is 2-[[1-[(3-chlorophenyl)methyl]triazol-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[1-[(3-chlorophenyl)methyl]triazol-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 177375988 |
| Molecular Formula | C18H13ClN4O2 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-[[1-[(3-chlorophenyl)methyl]triazol-4-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cn(Cc2cccc(Cl)c2)nn1 |
| InChI | InChI=1S/C18H13ClN4O2/c19-13-5-3-4-12(8-13)9-22-10-14(20-21-22)11-23-17(24)15-6-1-2-7-16(15)18(23)25/h1-8,10H,9,11H2 |
| InChIKey | NBVAEQYIVGLLBB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|