C21H19ClN6O3 — CID 71615476
1-[3-(chloromethyl)phenyl]-3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]triazol-4-yl]methyl]urea (PubChem CID 71615476) has the molecular formula C21H19ClN6O3 and a molecular weight of 438.88 g/mol. Its IUPAC name is 1-[3-(chloromethyl)phenyl]-3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]triazol-4-yl]methyl]urea.
| Compound Name | 1-[3-(chloromethyl)phenyl]-3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]triazol-4-yl]methyl]urea |
|---|---|
| PubChem CID | 71615476 |
| Molecular Formula | C21H19ClN6O3 |
| Molecular Weight | 438.88 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 1-[3-(chloromethyl)phenyl]-3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]triazol-4-yl]methyl]urea |
| SMILES | O=C(NCc1cn(CCN2C(=O)c3ccccc3C2=O)nn1)Nc1cccc(CCl)c1 |
| InChI | InChI=1S/C21H19ClN6O3/c22-11-14-4-3-5-15(10-14)24-21(31)23-12-16-13-27(26-25-16)8-9-28-19(29)17-6-1-2-7-18(17)20(28)30/h1-7,10,13H,8-9,11-12H2,(H2,23,24,31) |
| InChIKey | QWHFSANEDJHAFM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.88 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|