C14H19FN5O13P3 — CID 126723628
[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-3-(2-fluoroethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 126723628) has the molecular formula C14H19FN5O13P3 and a molecular weight of 577.25 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-3-(2-fluoroethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-3-(2-fluoroethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 126723628 |
| Molecular Formula | C14H19FN5O13P3 |
| Molecular Weight | 577.25 g/mol |
| Exact Mass | 577.02 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-3-(2-fluoroethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(O)[C@H](n2cnc3c(N)ncnc32)O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@]1(O)CCF |
| InChI | InChI=1S/C14H19FN5O13P3/c1-2-13(21)12(20-7-19-9-10(16)17-6-18-11(9)20)31-8(14(13,22)3-4-15)5-30-35(26,27)33-36(28,29)32-34(23,24)25/h1,6-8,12,21-22H,3-5H2,(H,26,27)(H,28,29)(H2,16,17,18)(H2,23,24,25)/t8-,12-,13+,14-/m1/s1 |
| InChIKey | CGCKPMYJIQVOSK-ULTHFGNCSA-N |
| XLogP | -0.90 |
| TPSA | 279.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.25 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|