C13H15FN5O13P3 — CID 129150005
[(1R,3R,4R,5S)-3-(6-aminopurin-9-yl)-4-ethynyl-1-(fluoromethyl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 129150005) has the molecular formula C13H15FN5O13P3 and a molecular weight of 561.21 g/mol. Its IUPAC name is [(1R,3R,4R,5S)-3-(6-aminopurin-9-yl)-4-ethynyl-1-(fluoromethyl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(1R,3R,4R,5S)-3-(6-aminopurin-9-yl)-4-ethynyl-1-(fluoromethyl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 129150005 |
| Molecular Formula | C13H15FN5O13P3 |
| Molecular Weight | 561.21 g/mol |
| Exact Mass | 560.99 |
| IUPAC Name | [(1R,3R,4R,5S)-3-(6-aminopurin-9-yl)-4-ethynyl-1-(fluoromethyl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | C#C[C@]1(O)[C@H](n2cnc3c(N)ncnc32)O[C@]2(CF)C(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@]21O |
| InChI | InChI=1S/C13H15FN5O13P3/c1-2-11(20)10(19-5-18-6-7(15)16-4-17-8(6)19)29-12(3-14)9(13(11,12)21)30-34(25,26)32-35(27,28)31-33(22,23)24/h1,4-5,9-10,20-21H,3H2,(H,25,26)(H,27,28)(H2,15,16,17)(H2,22,23,24)/t9?,10-,11+,12-,13+/m1/s1 |
| InChIKey | IZNCYRSQDXBNNQ-LLUNPGSJSA-N |
| XLogP | -1.53 |
| TPSA | 279.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.21 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|