C13H12FN5O4 — CID 144985511
(1R,3R,4R,5R)-3-(6-aminopurin-9-yl)-4-ethynyl-1-(fluoromethyl)-2-oxabicyclo[3.1.0]hexane-4,5,6-triol (PubChem CID 144985511) has the molecular formula C13H12FN5O4 and a molecular weight of 321.27 g/mol. Its IUPAC name is (1R,3R,4R,5R)-3-(6-aminopurin-9-yl)-4-ethynyl-1-(fluoromethyl)-2-oxabicyclo[3.1.0]hexane-4,5,6-triol.
| Compound Name | (1R,3R,4R,5R)-3-(6-aminopurin-9-yl)-4-ethynyl-1-(fluoromethyl)-2-oxabicyclo[3.1.0]hexane-4,5,6-triol |
|---|---|
| PubChem CID | 144985511 |
| Molecular Formula | C13H12FN5O4 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (1R,3R,4R,5R)-3-(6-aminopurin-9-yl)-4-ethynyl-1-(fluoromethyl)-2-oxabicyclo[3.1.0]hexane-4,5,6-triol |
| SMILES | C#C[C@]1(O)[C@H](n2cnc3c(N)ncnc32)O[C@]2(CF)C(O)[C@]21O |
| InChI | InChI=1S/C13H12FN5O4/c1-2-11(21)10(23-12(3-14)9(20)13(11,12)22)19-5-18-6-7(15)16-4-17-8(6)19/h1,4-5,9-10,20-22H,3H2,(H2,15,16,17)/t9?,10-,11+,12-,13-/m1/s1 |
| InChIKey | DPTOUSFGGDOFPA-ZLOUSURVSA-N |
| XLogP | -1.88 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|