C14H17N5O4 — CID 144766649
(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-2-(methoxymethyl)-2-methyloxolane-3,4-diol (PubChem CID 144766649) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-2-(methoxymethyl)-2-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-2-(methoxymethyl)-2-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 144766649 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-2-(methoxymethyl)-2-methyloxolane-3,4-diol |
| SMILES | C#C[C@]1(O)[C@H](n2cnc3c(N)ncnc32)O[C@](C)(COC)[C@H]1O |
| InChI | InChI=1S/C14H17N5O4/c1-4-14(21)11(20)13(2,5-22-3)23-12(14)19-7-18-8-9(15)16-6-17-10(8)19/h1,6-7,11-12,20-21H,5H2,2-3H3,(H2,15,16,17)/t11-,12-,13-,14-/m1/s1 |
| InChIKey | HQDBATGEUFHSOS-AAVRWANBSA-N |
| XLogP | -0.93 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|